C14H16BrNO3 — CID 43464484
(2-bromo-4,5-dimethoxyphenyl)-(5-methylfuran-2-yl)methanamine (PubChem CID 43464484) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(5-methylfuran-2-yl)methanamine.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(5-methylfuran-2-yl)methanamine |
|---|---|
| PubChem CID | 43464484 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(5-methylfuran-2-yl)methanamine |
| SMILES | COc1cc(Br)c(C(N)c2ccc(C)o2)cc1OC |
| InChI | InChI=1S/C14H16BrNO3/c1-8-4-5-11(19-8)14(16)9-6-12(17-2)13(18-3)7-10(9)15/h4-7,14H,16H2,1-3H3 |
| InChIKey | GMXXGQMIXYLXOM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |