C13H11Br3O3 — CID 63440860
2-bromo-5-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]furan (PubChem CID 63440860) has the molecular formula C13H11Br3O3 and a molecular weight of 454.94 g/mol. Its IUPAC name is 2-bromo-5-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]furan.
| Compound Name | 2-bromo-5-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]furan |
|---|---|
| PubChem CID | 63440860 |
| Molecular Formula | C13H11Br3O3 |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 451.83 |
| IUPAC Name | 2-bromo-5-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]furan |
| SMILES | COc1cc(Br)c(C(Br)c2ccc(Br)o2)cc1OC |
| InChI | InChI=1S/C13H11Br3O3/c1-17-10-5-7(8(14)6-11(10)18-2)13(16)9-3-4-12(15)19-9/h3-6,13H,1-2H3 |
| InChIKey | YSQCTQUYPXJYEF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|