C14H14Br2O3S — CID 81124391
2-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methoxythiophene (PubChem CID 81124391) has the molecular formula C14H14Br2O3S and a molecular weight of 422.14 g/mol. Its IUPAC name is 2-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methoxythiophene.
| Compound Name | 2-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methoxythiophene |
|---|---|
| PubChem CID | 81124391 |
| Molecular Formula | C14H14Br2O3S |
| Molecular Weight | 422.14 g/mol |
| Exact Mass | 419.90 |
| IUPAC Name | 2-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-3-methoxythiophene |
| SMILES | COc1cc(Br)c(C(Br)c2sccc2OC)cc1OC |
| InChI | InChI=1S/C14H14Br2O3S/c1-17-10-4-5-20-14(10)13(16)8-6-11(18-2)12(19-3)7-9(8)15/h4-7,13H,1-3H3 |
| InChIKey | HHWYKKGUBOOMRW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.14 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|