C15H17BrO2S — CID 83068073
2-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-3-methoxythiophene (PubChem CID 83068073) has the molecular formula C15H17BrO2S and a molecular weight of 341.27 g/mol. Its IUPAC name is 2-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-3-methoxythiophene.
| Compound Name | 2-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-3-methoxythiophene |
|---|---|
| PubChem CID | 83068073 |
| Molecular Formula | C15H17BrO2S |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-3-methoxythiophene |
| SMILES | COc1ccsc1C(Br)c1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C15H17BrO2S/c1-9-7-11(8-10(2)14(9)18-4)13(16)15-12(17-3)5-6-19-15/h5-8,13H,1-4H3 |
| InChIKey | OFNGNULCQHDOHI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|