C14H14ClFOS — CID 81124104
2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-3-methoxythiophene (PubChem CID 81124104) has the molecular formula C14H14ClFOS and a molecular weight of 284.78 g/mol. Its IUPAC name is 2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-3-methoxythiophene.
| Compound Name | 2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-3-methoxythiophene |
|---|---|
| PubChem CID | 81124104 |
| Molecular Formula | C14H14ClFOS |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-3-methoxythiophene |
| SMILES | COc1ccsc1C(Cl)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C14H14ClFOS/c1-8-6-10(7-9(2)13(8)16)12(15)14-11(17-3)4-5-18-14/h4-7,12H,1-3H3 |
| InChIKey | RBLCENYGAHXAQV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|