C16H15Cl2FO — CID 65296595
5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-2-fluoro-1,3-dimethylbenzene (PubChem CID 65296595) has the molecular formula C16H15Cl2FO and a molecular weight of 313.20 g/mol. Its IUPAC name is 5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-2-fluoro-1,3-dimethylbenzene.
| Compound Name | 5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-2-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 65296595 |
| Molecular Formula | C16H15Cl2FO |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-2-fluoro-1,3-dimethylbenzene |
| SMILES | COc1ccc(Cl)cc1C(Cl)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C16H15Cl2FO/c1-9-6-11(7-10(2)16(9)19)15(18)13-8-12(17)4-5-14(13)20-3/h4-8,15H,1-3H3 |
| InChIKey | JZLNWBDONMDOHN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|