C16H16Cl2O — CID 63427370
4-chloro-2-[chloro-(3,4-dimethylphenyl)methyl]-1-methoxybenzene (PubChem CID 63427370) has the molecular formula C16H16Cl2O and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-chloro-2-[chloro-(3,4-dimethylphenyl)methyl]-1-methoxybenzene.
| Compound Name | 4-chloro-2-[chloro-(3,4-dimethylphenyl)methyl]-1-methoxybenzene |
|---|---|
| PubChem CID | 63427370 |
| Molecular Formula | C16H16Cl2O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 4-chloro-2-[chloro-(3,4-dimethylphenyl)methyl]-1-methoxybenzene |
| SMILES | COc1ccc(Cl)cc1C(Cl)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H16Cl2O/c1-10-4-5-12(8-11(10)2)16(18)14-9-13(17)6-7-15(14)19-3/h4-9,16H,1-3H3 |
| InChIKey | BKGIOUSXIXOXCS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|