C16H16BrClO2 — CID 82890864
2-[bromo-(3,4-dimethoxyphenyl)methyl]-4-chloro-1-methylbenzene (PubChem CID 82890864) has the molecular formula C16H16BrClO2 and a molecular weight of 355.66 g/mol. Its IUPAC name is 2-[bromo-(3,4-dimethoxyphenyl)methyl]-4-chloro-1-methylbenzene.
| Compound Name | 2-[bromo-(3,4-dimethoxyphenyl)methyl]-4-chloro-1-methylbenzene |
|---|---|
| PubChem CID | 82890864 |
| Molecular Formula | C16H16BrClO2 |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-[bromo-(3,4-dimethoxyphenyl)methyl]-4-chloro-1-methylbenzene |
| SMILES | COc1ccc(C(Br)c2cc(Cl)ccc2C)cc1OC |
| InChI | InChI=1S/C16H16BrClO2/c1-10-4-6-12(18)9-13(10)16(17)11-5-7-14(19-2)15(8-11)20-3/h4-9,16H,1-3H3 |
| InChIKey | MEHMGXCWPZBYEV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|