C16H14Cl2O2 — CID 63020619
5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 63020619) has the molecular formula C16H14Cl2O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is 5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,3-dihydro-2-benzofuran.
| Compound Name | 5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 63020619 |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 5-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | COc1ccc(Cl)cc1C(Cl)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C16H14Cl2O2/c1-19-15-5-4-13(17)7-14(15)16(18)10-2-3-11-8-20-9-12(11)6-10/h2-7,16H,8-9H2,1H3 |
| InChIKey | SLUOMTXZGWIACD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|