C13H11Cl2FS — CID 80640930
3-chloro-2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]thiophene (PubChem CID 80640930) has the molecular formula C13H11Cl2FS and a molecular weight of 289.20 g/mol. Its IUPAC name is 3-chloro-2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]thiophene.
| Compound Name | 3-chloro-2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 80640930 |
| Molecular Formula | C13H11Cl2FS |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3-chloro-2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]thiophene |
| SMILES | Cc1cc(C(Cl)c2sccc2Cl)cc(C)c1F |
| InChI | InChI=1S/C13H11Cl2FS/c1-7-5-9(6-8(2)12(7)16)11(15)13-10(14)3-4-17-13/h3-6,11H,1-2H3 |
| InChIKey | ZAVHJQKOUGFOOC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|