C13H11ClFIS — CID 79684320
4-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-2-iodothiophene (PubChem CID 79684320) has the molecular formula C13H11ClFIS and a molecular weight of 380.65 g/mol. Its IUPAC name is 4-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-2-iodothiophene.
| Compound Name | 4-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-2-iodothiophene |
|---|---|
| PubChem CID | 79684320 |
| Molecular Formula | C13H11ClFIS |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 4-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-2-iodothiophene |
| SMILES | Cc1cc(C(Cl)c2csc(I)c2)cc(C)c1F |
| InChI | InChI=1S/C13H11ClFIS/c1-7-3-9(4-8(2)13(7)15)12(14)10-5-11(16)17-6-10/h3-6,12H,1-2H3 |
| InChIKey | QEVPELQDPZBSSB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|