C15H12Br2ClF — CID 107980953
5-[chloro-(3,5-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene (PubChem CID 107980953) has the molecular formula C15H12Br2ClF and a molecular weight of 406.52 g/mol. Its IUPAC name is 5-[chloro-(3,5-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene.
| Compound Name | 5-[chloro-(3,5-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 107980953 |
| Molecular Formula | C15H12Br2ClF |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 403.90 |
| IUPAC Name | 5-[chloro-(3,5-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(C(Cl)c2cc(Br)cc(Br)c2)cc(C)c1F |
| InChI | InChI=1S/C15H12Br2ClF/c1-8-3-10(4-9(2)15(8)19)14(18)11-5-12(16)7-13(17)6-11/h3-7,14H,1-2H3 |
| InChIKey | NVCPZODALQDGFR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|