C16H14ClF3 — CID 82816267
2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-1,3-difluoro-4-methylbenzene (PubChem CID 82816267) has the molecular formula C16H14ClF3 and a molecular weight of 298.74 g/mol. Its IUPAC name is 2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-1,3-difluoro-4-methylbenzene.
| Compound Name | 2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-1,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 82816267 |
| Molecular Formula | C16H14ClF3 |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[chloro-(4-fluoro-3,5-dimethylphenyl)methyl]-1,3-difluoro-4-methylbenzene |
| SMILES | Cc1cc(C(Cl)c2c(F)ccc(C)c2F)cc(C)c1F |
| InChI | InChI=1S/C16H14ClF3/c1-8-4-5-12(18)13(16(8)20)14(17)11-6-9(2)15(19)10(3)7-11/h4-7,14H,1-3H3 |
| InChIKey | XXHACSUNKWNMHX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|