C16H13ClF2O2 — CID 82799538
6-[chloro-(2,6-difluoro-3-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 82799538) has the molecular formula C16H13ClF2O2 and a molecular weight of 310.73 g/mol. Its IUPAC name is 6-[chloro-(2,6-difluoro-3-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[chloro-(2,6-difluoro-3-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 82799538 |
| Molecular Formula | C16H13ClF2O2 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 6-[chloro-(2,6-difluoro-3-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1ccc(F)c(C(Cl)c2ccc3c(c2)OCCO3)c1F |
| InChI | InChI=1S/C16H13ClF2O2/c1-9-2-4-11(18)14(16(9)19)15(17)10-3-5-12-13(8-10)21-7-6-20-12/h2-5,8,15H,6-7H2,1H3 |
| InChIKey | XFRMQOYVMCCVFY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|