C17H17ClF2 — CID 82815966
2-[chloro-(4-propan-2-ylphenyl)methyl]-1,3-difluoro-4-methylbenzene (PubChem CID 82815966) has the molecular formula C17H17ClF2 and a molecular weight of 294.77 g/mol. Its IUPAC name is 2-[chloro-(4-propan-2-ylphenyl)methyl]-1,3-difluoro-4-methylbenzene.
| Compound Name | 2-[chloro-(4-propan-2-ylphenyl)methyl]-1,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 82815966 |
| Molecular Formula | C17H17ClF2 |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[chloro-(4-propan-2-ylphenyl)methyl]-1,3-difluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)c(C(Cl)c2ccc(C(C)C)cc2)c1F |
| InChI | InChI=1S/C17H17ClF2/c1-10(2)12-5-7-13(8-6-12)16(18)15-14(19)9-4-11(3)17(15)20/h4-10,16H,1-3H3 |
| InChIKey | OLFPVFPCUOSNCO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|