C12H7BrCl2F2S — CID 82816642
2-bromo-3-chloro-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene (PubChem CID 82816642) has the molecular formula C12H7BrCl2F2S and a molecular weight of 372.06 g/mol. Its IUPAC name is 2-bromo-3-chloro-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene.
| Compound Name | 2-bromo-3-chloro-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 82816642 |
| Molecular Formula | C12H7BrCl2F2S |
| Molecular Weight | 372.06 g/mol |
| Exact Mass | 369.88 |
| IUPAC Name | 2-bromo-3-chloro-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene |
| SMILES | Cc1ccc(F)c(C(Cl)c2cc(Cl)c(Br)s2)c1F |
| InChI | InChI=1S/C12H7BrCl2F2S/c1-5-2-3-7(16)9(11(5)17)10(15)8-4-6(14)12(13)18-8/h2-4,10H,1H3 |
| InChIKey | KJXDCPMYXBWPCJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.06 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|