C16H17ClF2S — CID 82816269
2-tert-butyl-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene (PubChem CID 82816269) has the molecular formula C16H17ClF2S and a molecular weight of 314.83 g/mol. Its IUPAC name is 2-tert-butyl-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene.
| Compound Name | 2-tert-butyl-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 82816269 |
| Molecular Formula | C16H17ClF2S |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-tert-butyl-5-[chloro-(2,6-difluoro-3-methylphenyl)methyl]thiophene |
| SMILES | Cc1ccc(F)c(C(Cl)c2ccc(C(C)(C)C)s2)c1F |
| InChI | InChI=1S/C16H17ClF2S/c1-9-5-6-10(18)13(15(9)19)14(17)11-7-8-12(20-11)16(2,3)4/h5-8,14H,1-4H3 |
| InChIKey | WLYXXAFGGWBUSA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|