C15H11ClF4O — CID 82799527
2-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]-1,3-difluoro-4-methylbenzene (PubChem CID 82799527) has the molecular formula C15H11ClF4O and a molecular weight of 318.70 g/mol. Its IUPAC name is 2-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]-1,3-difluoro-4-methylbenzene.
| Compound Name | 2-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]-1,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 82799527 |
| Molecular Formula | C15H11ClF4O |
| Molecular Weight | 318.70 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]-1,3-difluoro-4-methylbenzene |
| SMILES | COc1cc(F)c(C(Cl)c2c(F)ccc(C)c2F)c(F)c1 |
| InChI | InChI=1S/C15H11ClF4O/c1-7-3-4-9(17)13(15(7)20)14(16)12-10(18)5-8(21-2)6-11(12)19/h3-6,14H,1-2H3 |
| InChIKey | OCCRVOOSCXXCCF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.70 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|