C14H8ClF5 — CID 63428655
1-[chloro-(4-methylphenyl)methyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 63428655) has the molecular formula C14H8ClF5 and a molecular weight of 306.66 g/mol. Its IUPAC name is 1-[chloro-(4-methylphenyl)methyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[chloro-(4-methylphenyl)methyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 63428655 |
| Molecular Formula | C14H8ClF5 |
| Molecular Weight | 306.66 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 1-[chloro-(4-methylphenyl)methyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Cc1ccc(C(Cl)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H8ClF5/c1-6-2-4-7(5-3-6)9(15)8-10(16)12(18)14(20)13(19)11(8)17/h2-5,9H,1H3 |
| InChIKey | IWCDAALMWKNLGK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|