C16H13ClF4 — CID 106879788
2-[chloro-[4-(trifluoromethyl)phenyl]methyl]-5-fluoro-1,3-dimethylbenzene (PubChem CID 106879788) has the molecular formula C16H13ClF4 and a molecular weight of 316.73 g/mol. Its IUPAC name is 2-[chloro-[4-(trifluoromethyl)phenyl]methyl]-5-fluoro-1,3-dimethylbenzene.
| Compound Name | 2-[chloro-[4-(trifluoromethyl)phenyl]methyl]-5-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 106879788 |
| Molecular Formula | C16H13ClF4 |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[chloro-[4-(trifluoromethyl)phenyl]methyl]-5-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(F)cc(C)c1C(Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13ClF4/c1-9-7-13(18)8-10(2)14(9)15(17)11-3-5-12(6-4-11)16(19,20)21/h3-8,15H,1-2H3 |
| InChIKey | CAVDRLDTMWGOSR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|