C14H14ClFS — CID 106879791
2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-5-methylthiophene (PubChem CID 106879791) has the molecular formula C14H14ClFS and a molecular weight of 268.78 g/mol. Its IUPAC name is 2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-5-methylthiophene.
| Compound Name | 2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 106879791 |
| Molecular Formula | C14H14ClFS |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-5-methylthiophene |
| SMILES | Cc1ccc(C(Cl)c2c(C)cc(F)cc2C)s1 |
| InChI | InChI=1S/C14H14ClFS/c1-8-6-11(16)7-9(2)13(8)14(15)12-5-4-10(3)17-12/h4-7,14H,1-3H3 |
| InChIKey | YARUHCRRFAQUNE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|