C14H14ClFO — CID 106879675
2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-3-methylfuran (PubChem CID 106879675) has the molecular formula C14H14ClFO and a molecular weight of 252.72 g/mol. Its IUPAC name is 2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-3-methylfuran.
| Compound Name | 2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-3-methylfuran |
|---|---|
| PubChem CID | 106879675 |
| Molecular Formula | C14H14ClFO |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-[chloro-(4-fluoro-2,6-dimethylphenyl)methyl]-3-methylfuran |
| SMILES | Cc1ccoc1C(Cl)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C14H14ClFO/c1-8-4-5-17-14(8)13(15)12-9(2)6-11(16)7-10(12)3/h4-7,13H,1-3H3 |
| InChIKey | LQJZFZXBJDYHGT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|