C12H10F2O2 — CID 61087172
(2,4-difluorophenyl)-(3-methylfuran-2-yl)methanol (PubChem CID 61087172) has the molecular formula C12H10F2O2 and a molecular weight of 224.21 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(3-methylfuran-2-yl)methanol.
| Compound Name | (2,4-difluorophenyl)-(3-methylfuran-2-yl)methanol |
|---|---|
| PubChem CID | 61087172 |
| Molecular Formula | C12H10F2O2 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (2,4-difluorophenyl)-(3-methylfuran-2-yl)methanol |
| SMILES | Cc1ccoc1C(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H10F2O2/c1-7-4-5-16-12(7)11(15)9-3-2-8(13)6-10(9)14/h2-6,11,15H,1H3 |
| InChIKey | YJLZUCTXFJKJIF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |