2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid

C12H8F2O4 — CID 107432210

IUPAC2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid
SMILESO=C(O)c1ccoc1C(O)c1cc(F)ccc1F
InChIInChI=1S/C12H8F2O4/c13-6-1-2-9(14)8(5-6)10(15)11-7(12(16)17)3-4-18-11/h1-5,10,15H,(H,16,17)
InChIKeyDLMFVRCEXQQHSF-UHFFFAOYSA-N
MW254.19 g/mol
LogP2.34
Rot. Bonds3

About 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid

2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid (PubChem CID 107432210) has the molecular formula C12H8F2O4 and a molecular weight of 254.19 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid.

Molecular Properties

Compound Name2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid
PubChem CID107432210
Molecular FormulaC12H8F2O4
Molecular Weight254.19 g/mol
Exact Mass254.04
IUPAC Name2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid
SMILESO=C(O)c1ccoc1C(O)c1cc(F)ccc1F
InChIInChI=1S/C12H8F2O4/c13-6-1-2-9(14)8(5-6)10(15)11-7(12(16)17)3-4-18-11/h1-5,10,15H,(H,16,17)
InChIKeyDLMFVRCEXQQHSF-UHFFFAOYSA-N
XLogP2.34
TPSA70.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.19
LogP ≤ 52.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid?
The IUPAC name of 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid (CID 107432210) is 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid.
What is the SMILES notation for 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid?
The canonical SMILES for 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid is O=C(O)c1ccoc1C(O)c1cc(F)ccc1F.
What is the InChIKey of 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid?
The InChIKey is DLMFVRCEXQQHSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2O4/c13-6-1-2-9(14)8(5-6)10(15)11-7(12(16)17)3-4-18-11/h1-5,10,15H,(H,16,17).
What are the key properties of 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid?
2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid has a molecular weight of 254.19 g/mol, XLogP of 2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-difluorophenyl)-hydroxymethyl]furan-3-carboxylic acid is sourced from PubChem (CID 107432210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).