C13H9F3O4 — CID 107432177
2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxylic acid (PubChem CID 107432177) has the molecular formula C13H9F3O4 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxylic acid.
| Compound Name | 2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 107432177 |
| Molecular Formula | C13H9F3O4 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1C(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F3O4/c14-13(15,16)8-3-1-2-7(6-8)10(17)11-9(12(18)19)4-5-20-11/h1-6,10,17H,(H,18,19) |
| InChIKey | OPJHJDZPBJILCQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |