C14H9Br2F3O — CID 107978303
(3,5-dibromophenyl)-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 107978303) has the molecular formula C14H9Br2F3O and a molecular weight of 410.03 g/mol. Its IUPAC name is (3,5-dibromophenyl)-[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | (3,5-dibromophenyl)-[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 107978303 |
| Molecular Formula | C14H9Br2F3O |
| Molecular Weight | 410.03 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | (3,5-dibromophenyl)-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1cc(Br)cc(Br)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9Br2F3O/c15-11-5-9(6-12(16)7-11)13(20)8-2-1-3-10(4-8)14(17,18)19/h1-7,13,20H |
| InChIKey | ZARKAKFRTMINGK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.03 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |