(3,5-dibromophenyl)-(3-fluorophenyl)methanol

C13H9Br2FO — CID 107978141

IUPAC(3,5-dibromophenyl)-(3-fluorophenyl)methanol
SMILESOC(c1cccc(F)c1)c1cc(Br)cc(Br)c1
InChIInChI=1S/C13H9Br2FO/c14-10-4-9(5-11(15)7-10)13(17)8-2-1-3-12(16)6-8/h1-7,13,17H
InChIKeySGNBOXYZWOAMEX-UHFFFAOYSA-N
MW360.02 g/mol
LogP4.43
Rot. Bonds2

About (3,5-dibromophenyl)-(3-fluorophenyl)methanol

(3,5-dibromophenyl)-(3-fluorophenyl)methanol (PubChem CID 107978141) has the molecular formula C13H9Br2FO and a molecular weight of 360.02 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(3-fluorophenyl)methanol.

Molecular Properties

Compound Name(3,5-dibromophenyl)-(3-fluorophenyl)methanol
PubChem CID107978141
Molecular FormulaC13H9Br2FO
Molecular Weight360.02 g/mol
Exact Mass357.90
IUPAC Name(3,5-dibromophenyl)-(3-fluorophenyl)methanol
SMILESOC(c1cccc(F)c1)c1cc(Br)cc(Br)c1
InChIInChI=1S/C13H9Br2FO/c14-10-4-9(5-11(15)7-10)13(17)8-2-1-3-12(16)6-8/h1-7,13,17H
InChIKeySGNBOXYZWOAMEX-UHFFFAOYSA-N
XLogP4.43
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.02
LogP ≤ 54.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (3,5-dibromophenyl)-(3-fluorophenyl)methanol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(S)-(3-bromophenyl)-(3,5-difluorophenyl)methanol
CID 94601821
(3,5-dibromophenyl)-[3-(trifluoromethyl)phenyl]methanol
CID 107978303
(R)-(3-chloro-5-fluorophenyl)-(3-fluorophenyl)methanol
CID 7146499
(4-fluoro-3,5-dimethylphenyl)-(3-fluorophenyl)methanol
CID 65296831
(5-bromo-2-fluorophenyl)-(3-fluorophenyl)methanol
CID 63893368
(3-bromo-5-fluorophenyl)-(3-cyclobutylphenyl)methanol
CID 114602324
(3,5-dibromophenyl)-(3-ethylphenyl)methanol
CID 107978572
(R)-(3,4-dichlorophenyl)-(3-fluorophenyl)methanol
CID 7153378
(3-bromo-5-fluorophenyl)-(3-fluorophenyl)methanamine
CID 66423670
(3,5-dibromophenyl)-(4-fluoro-3-methylphenyl)methanol
CID 107978317
(4-bromothiophen-3-yl)-(3-fluorophenyl)methanol
CID 79595378
(3-bromo-5-fluorophenyl)-(4-fluoro-3-methylphenyl)methanol
CID 66424633

Frequently Asked Questions

What is the IUPAC name of (3,5-dibromophenyl)-(3-fluorophenyl)methanol?
The IUPAC name of (3,5-dibromophenyl)-(3-fluorophenyl)methanol (CID 107978141) is (3,5-dibromophenyl)-(3-fluorophenyl)methanol.
What is the SMILES notation for (3,5-dibromophenyl)-(3-fluorophenyl)methanol?
The canonical SMILES for (3,5-dibromophenyl)-(3-fluorophenyl)methanol is OC(c1cccc(F)c1)c1cc(Br)cc(Br)c1.
What is the InChIKey of (3,5-dibromophenyl)-(3-fluorophenyl)methanol?
The InChIKey is SGNBOXYZWOAMEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Br2FO/c14-10-4-9(5-11(15)7-10)13(17)8-2-1-3-12(16)6-8/h1-7,13,17H.
What are the key properties of (3,5-dibromophenyl)-(3-fluorophenyl)methanol?
(3,5-dibromophenyl)-(3-fluorophenyl)methanol has a molecular weight of 360.02 g/mol, XLogP of 4.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dibromophenyl)-(3-fluorophenyl)methanol is sourced from PubChem (CID 107978141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).