C11H11F3O3 — CID 71379717
3,4-dihydroxy-4-[3-(trifluoromethyl)phenyl]butan-2-one (PubChem CID 71379717) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[3-(trifluoromethyl)phenyl]butan-2-one.
| Compound Name | 3,4-dihydroxy-4-[3-(trifluoromethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 71379717 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3,4-dihydroxy-4-[3-(trifluoromethyl)phenyl]butan-2-one |
| SMILES | CC(=O)C(O)C(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3O3/c1-6(15)9(16)10(17)7-3-2-4-8(5-7)11(12,13)14/h2-5,9-10,16-17H,1H3 |
| InChIKey | FLRXNRUXWPIRJB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |