C10H10BrF3O2 — CID 171860229
3-bromo-1-[3-(trifluoromethyl)phenyl]propane-1,2-diol (PubChem CID 171860229) has the molecular formula C10H10BrF3O2 and a molecular weight of 299.09 g/mol. Its IUPAC name is 3-bromo-1-[3-(trifluoromethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-bromo-1-[3-(trifluoromethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 171860229 |
| Molecular Formula | C10H10BrF3O2 |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 3-bromo-1-[3-(trifluoromethyl)phenyl]propane-1,2-diol |
| SMILES | OC(CBr)C(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10BrF3O2/c11-5-8(15)9(16)6-2-1-3-7(4-6)10(12,13)14/h1-4,8-9,15-16H,5H2 |
| InChIKey | RSFSXPPFRWATOX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|