C16H16F3NO — CID 62720952
2-amino-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 62720952) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-amino-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2-amino-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 62720952 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-amino-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | NC(Cc1ccccc1)C(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3NO/c17-16(18,19)13-8-4-7-12(10-13)15(21)14(20)9-11-5-2-1-3-6-11/h1-8,10,14-15,21H,9,20H2 |
| InChIKey | BAVGSQQBYWDWEM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |