C15H18O5 — CID 61082570
(3-methylfuran-2-yl)-(2,3,4-trimethoxyphenyl)methanol (PubChem CID 61082570) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3-methylfuran-2-yl)-(2,3,4-trimethoxyphenyl)methanol.
| Compound Name | (3-methylfuran-2-yl)-(2,3,4-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 61082570 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3-methylfuran-2-yl)-(2,3,4-trimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2occc2C)c(OC)c1OC |
| InChI | InChI=1S/C15H18O5/c1-9-7-8-20-13(9)12(16)10-5-6-11(17-2)15(19-4)14(10)18-3/h5-8,12,16H,1-4H3 |
| InChIKey | JIHRRWAELXULKL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |