C14H14Br2O4 — CID 106855607
2-bromo-3-[bromo-(2,3,4-trimethoxyphenyl)methyl]furan (PubChem CID 106855607) has the molecular formula C14H14Br2O4 and a molecular weight of 406.07 g/mol. Its IUPAC name is 2-bromo-3-[bromo-(2,3,4-trimethoxyphenyl)methyl]furan.
| Compound Name | 2-bromo-3-[bromo-(2,3,4-trimethoxyphenyl)methyl]furan |
|---|---|
| PubChem CID | 106855607 |
| Molecular Formula | C14H14Br2O4 |
| Molecular Weight | 406.07 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | 2-bromo-3-[bromo-(2,3,4-trimethoxyphenyl)methyl]furan |
| SMILES | COc1ccc(C(Br)c2ccoc2Br)c(OC)c1OC |
| InChI | InChI=1S/C14H14Br2O4/c1-17-10-5-4-8(12(18-2)13(10)19-3)11(15)9-6-7-20-14(9)16/h4-7,11H,1-3H3 |
| InChIKey | QRSHBTGDKFWZBA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.07 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|