C16H19BrO3S — CID 61098951
3-[bromo-(2,3,4-trimethoxyphenyl)methyl]-2,5-dimethylthiophene (PubChem CID 61098951) has the molecular formula C16H19BrO3S and a molecular weight of 371.30 g/mol. Its IUPAC name is 3-[bromo-(2,3,4-trimethoxyphenyl)methyl]-2,5-dimethylthiophene.
| Compound Name | 3-[bromo-(2,3,4-trimethoxyphenyl)methyl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 61098951 |
| Molecular Formula | C16H19BrO3S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3-[bromo-(2,3,4-trimethoxyphenyl)methyl]-2,5-dimethylthiophene |
| SMILES | COc1ccc(C(Br)c2cc(C)sc2C)c(OC)c1OC |
| InChI | InChI=1S/C16H19BrO3S/c1-9-8-12(10(2)21-9)14(17)11-6-7-13(18-3)16(20-5)15(11)19-4/h6-8,14H,1-5H3 |
| InChIKey | PSFGZAKWJPEBGJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|