C10H12Br2O3 — CID 87568528
1-(dibromomethyl)-2,3,4-trimethoxybenzene (PubChem CID 87568528) has the molecular formula C10H12Br2O3 and a molecular weight of 340.01 g/mol. Its IUPAC name is 1-(dibromomethyl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(dibromomethyl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 87568528 |
| Molecular Formula | C10H12Br2O3 |
| Molecular Weight | 340.01 g/mol |
| Exact Mass | 337.92 |
| IUPAC Name | 1-(dibromomethyl)-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(C(Br)Br)c(OC)c1OC |
| InChI | InChI=1S/C10H12Br2O3/c1-13-7-5-4-6(10(11)12)8(14-2)9(7)15-3/h4-5,10H,1-3H3 |
| InChIKey | ZXWJDVGHPSAHBF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.01 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|