C14H21BrO3 — CID 83934039
1-(4-bromo-3-methylbutan-2-yl)-2,3,4-trimethoxybenzene (PubChem CID 83934039) has the molecular formula C14H21BrO3 and a molecular weight of 317.22 g/mol. Its IUPAC name is 1-(4-bromo-3-methylbutan-2-yl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(4-bromo-3-methylbutan-2-yl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 83934039 |
| Molecular Formula | C14H21BrO3 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-(4-bromo-3-methylbutan-2-yl)-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(C(C)C(C)CBr)c(OC)c1OC |
| InChI | InChI=1S/C14H21BrO3/c1-9(8-15)10(2)11-6-7-12(16-3)14(18-5)13(11)17-4/h6-7,9-10H,8H2,1-5H3 |
| InChIKey | CVVXMVJQKLEMOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|