C15H22O3 — CID 83934116
1-[(Z)-hex-4-en-2-yl]-2,3,4-trimethoxybenzene (PubChem CID 83934116) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[(Z)-hex-4-en-2-yl]-2,3,4-trimethoxybenzene.
| Compound Name | 1-[(Z)-hex-4-en-2-yl]-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 83934116 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-[(Z)-hex-4-en-2-yl]-2,3,4-trimethoxybenzene |
| SMILES | C/C=C\CC(C)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C15H22O3/c1-6-7-8-11(2)12-9-10-13(16-3)15(18-5)14(12)17-4/h6-7,9-11H,8H2,1-5H3/b7-6- |
| InChIKey | YCQGCKNJSNEJEZ-SREVYHEPSA-N |
| XLogP | 3.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|