C11H15BrO3 — CID 61096403
1-(1-bromoethyl)-2,3,4-trimethoxybenzene (PubChem CID 61096403) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is 1-(1-bromoethyl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(1-bromoethyl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 61096403 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(1-bromoethyl)-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(C(C)Br)c(OC)c1OC |
| InChI | InChI=1S/C11H15BrO3/c1-7(12)8-5-6-9(13-2)11(15-4)10(8)14-3/h5-7H,1-4H3 |
| InChIKey | MBGKGKZIOHDDLM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|