C15H23BrO3 — CID 61096002
1-(1-bromo-3,3-dimethylbutyl)-2,3,4-trimethoxybenzene (PubChem CID 61096002) has the molecular formula C15H23BrO3 and a molecular weight of 331.25 g/mol. Its IUPAC name is 1-(1-bromo-3,3-dimethylbutyl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(1-bromo-3,3-dimethylbutyl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 61096002 |
| Molecular Formula | C15H23BrO3 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-(1-bromo-3,3-dimethylbutyl)-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(C(Br)CC(C)(C)C)c(OC)c1OC |
| InChI | InChI=1S/C15H23BrO3/c1-15(2,3)9-11(16)10-7-8-12(17-4)14(19-6)13(10)18-5/h7-8,11H,9H2,1-6H3 |
| InChIKey | SONQFJUUJJKZQN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|