C12H15F3O4 — CID 61082565
3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-ol (PubChem CID 61082565) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-ol.
| Compound Name | 3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 61082565 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(C(O)CC(F)(F)F)c(OC)c1OC |
| InChI | InChI=1S/C12H15F3O4/c1-17-9-5-4-7(8(16)6-12(13,14)15)10(18-2)11(9)19-3/h4-5,8,16H,6H2,1-3H3 |
| InChIKey | YLYYOVJKZOKGMZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |