C14H22O6S — CID 65148516
4-methylsulfonyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol (PubChem CID 65148516) has the molecular formula C14H22O6S and a molecular weight of 318.39 g/mol. Its IUPAC name is 4-methylsulfonyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol.
| Compound Name | 4-methylsulfonyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 65148516 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-methylsulfonyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol |
| SMILES | COc1ccc(C(O)CCCS(C)(=O)=O)c(OC)c1OC |
| InChI | InChI=1S/C14H22O6S/c1-18-12-8-7-10(13(19-2)14(12)20-3)11(15)6-5-9-21(4,16)17/h7-8,11,15H,5-6,9H2,1-4H3 |
| InChIKey | ZRLUIRGSTQNHGA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |