C12H17ClO4S — CID 115780241
1-(5-chloro-2-methoxyphenyl)-4-methylsulfonylbutan-1-ol (PubChem CID 115780241) has the molecular formula C12H17ClO4S and a molecular weight of 292.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-4-methylsulfonylbutan-1-ol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-4-methylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 115780241 |
| Molecular Formula | C12H17ClO4S |
| Molecular Weight | 292.78 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-4-methylsulfonylbutan-1-ol |
| SMILES | COc1ccc(Cl)cc1C(O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C12H17ClO4S/c1-17-12-6-5-9(13)8-10(12)11(14)4-3-7-18(2,15)16/h5-6,8,11,14H,3-4,7H2,1-2H3 |
| InChIKey | GJOXERFMFXLIRP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |