C13H19BrO4S — CID 65145596
1-(5-bromo-2-methoxyphenyl)-4-ethylsulfonylbutan-1-ol (PubChem CID 65145596) has the molecular formula C13H19BrO4S and a molecular weight of 351.26 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 65145596 |
| Molecular Formula | C13H19BrO4S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H19BrO4S/c1-3-19(16,17)8-4-5-12(15)11-9-10(14)6-7-13(11)18-2/h6-7,9,12,15H,3-5,8H2,1-2H3 |
| InChIKey | REZWBSLYKGXASP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |