C14H22O5S — CID 115803647
1-(2,6-dimethoxyphenyl)-4-ethylsulfonylbutan-1-ol (PubChem CID 115803647) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-(2,6-dimethoxyphenyl)-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 115803647 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C14H22O5S/c1-4-20(16,17)10-6-7-11(15)14-12(18-2)8-5-9-13(14)19-3/h5,8-9,11,15H,4,6-7,10H2,1-3H3 |
| InChIKey | GFRLLKYWBWOIFS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |