C12H18O3S — CID 116810152
1-(2,6-dimethoxyphenyl)-2-ethylsulfanylethanol (PubChem CID 116810152) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-2-ethylsulfanylethanol.
| Compound Name | 1-(2,6-dimethoxyphenyl)-2-ethylsulfanylethanol |
|---|---|
| PubChem CID | 116810152 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-2-ethylsulfanylethanol |
| SMILES | CCSCC(O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C12H18O3S/c1-4-16-8-9(13)12-10(14-2)6-5-7-11(12)15-3/h5-7,9,13H,4,8H2,1-3H3 |
| InChIKey | OXAALYGCTKEXSG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |