C14H22O4S — CID 65098384
(1R)-1-[2-(3-ethylsulfonylpropoxy)phenyl]propan-1-ol (PubChem CID 65098384) has the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. Its IUPAC name is (1R)-1-[2-(3-ethylsulfonylpropoxy)phenyl]propan-1-ol.
| Compound Name | (1R)-1-[2-(3-ethylsulfonylpropoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 65098384 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1R)-1-[2-(3-ethylsulfonylpropoxy)phenyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccccc1OCCCS(=O)(=O)CC |
| InChI | InChI=1S/C14H22O4S/c1-3-13(15)12-8-5-6-9-14(12)18-10-7-11-19(16,17)4-2/h5-6,8-9,13,15H,3-4,7,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | TVNLBNPNOLCKHO-CYBMUJFWSA-N |
| XLogP | 2.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|