C13H20O4S — CID 65097851
4-ethylsulfonyl-1-(2-methoxyphenyl)butan-1-ol (PubChem CID 65097851) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-ethylsulfonyl-1-(2-methoxyphenyl)butan-1-ol.
| Compound Name | 4-ethylsulfonyl-1-(2-methoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 65097851 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-ethylsulfonyl-1-(2-methoxyphenyl)butan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)c1ccccc1OC |
| InChI | InChI=1S/C13H20O4S/c1-3-18(15,16)10-6-8-12(14)11-7-4-5-9-13(11)17-2/h4-5,7,9,12,14H,3,6,8,10H2,1-2H3 |
| InChIKey | BHAISHIMZPOEGG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |