C11H13F3O4S — CID 65148158
3-methylsulfonyl-1-[2-(trifluoromethoxy)phenyl]propan-1-ol (PubChem CID 65148158) has the molecular formula C11H13F3O4S and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-methylsulfonyl-1-[2-(trifluoromethoxy)phenyl]propan-1-ol.
| Compound Name | 3-methylsulfonyl-1-[2-(trifluoromethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 65148158 |
| Molecular Formula | C11H13F3O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-methylsulfonyl-1-[2-(trifluoromethoxy)phenyl]propan-1-ol |
| SMILES | CS(=O)(=O)CCC(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C11H13F3O4S/c1-19(16,17)7-6-9(15)8-4-2-3-5-10(8)18-11(12,13)14/h2-5,9,15H,6-7H2,1H3 |
| InChIKey | FDXOKNGATFGYHX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |