C12H12F6O2 — CID 115515453
5,5,5-trifluoro-1-[2-(trifluoromethoxy)phenyl]pentan-1-ol (PubChem CID 115515453) has the molecular formula C12H12F6O2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[2-(trifluoromethoxy)phenyl]pentan-1-ol.
| Compound Name | 5,5,5-trifluoro-1-[2-(trifluoromethoxy)phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 115515453 |
| Molecular Formula | C12H12F6O2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5,5,5-trifluoro-1-[2-(trifluoromethoxy)phenyl]pentan-1-ol |
| SMILES | OC(CCCC(F)(F)F)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H12F6O2/c13-11(14,15)7-3-5-9(19)8-4-1-2-6-10(8)20-12(16,17)18/h1-2,4,6,9,19H,3,5,7H2 |
| InChIKey | FKFZRBVFODPRIX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |