C13H17F3O3 — CID 115515400
1-(2,3-dimethoxyphenyl)-5,5,5-trifluoropentan-1-ol (PubChem CID 115515400) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(2,3-dimethoxyphenyl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 115515400 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-5,5,5-trifluoropentan-1-ol |
| SMILES | COc1cccc(C(O)CCCC(F)(F)F)c1OC |
| InChI | InChI=1S/C13H17F3O3/c1-18-11-7-3-5-9(12(11)19-2)10(17)6-4-8-13(14,15)16/h3,5,7,10,17H,4,6,8H2,1-2H3 |
| InChIKey | LMVIBNYELLJAPH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |