C12H18O4 — CID 79567811
1-(2,3-dimethoxyphenyl)-2-ethoxyethanol (PubChem CID 79567811) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-2-ethoxyethanol.
| Compound Name | 1-(2,3-dimethoxyphenyl)-2-ethoxyethanol |
|---|---|
| PubChem CID | 79567811 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-2-ethoxyethanol |
| SMILES | CCOCC(O)c1cccc(OC)c1OC |
| InChI | InChI=1S/C12H18O4/c1-4-16-8-10(13)9-6-5-7-11(14-2)12(9)15-3/h5-7,10,13H,4,8H2,1-3H3 |
| InChIKey | LKFJYELEOJGIFD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |